C18H32N2O7S — CID 69280820
tert-butyl N-[(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-(2-butoxyethyl)carbamate (PubChem CID 69280820) has the molecular formula C18H32N2O7S and a molecular weight of 420.53 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-(2-butoxyethyl)carbamate.
| Compound Name | tert-butyl N-[(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-(2-butoxyethyl)carbamate |
|---|---|
| PubChem CID | 69280820 |
| Molecular Formula | C18H32N2O7S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | tert-butyl N-[(3aR,5R,6S,7R,7aR)-6,7-dihydroxy-5-(hydroxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-(2-butoxyethyl)carbamate |
| SMILES | CCCCOCCN(C(=O)OC(C)(C)C)C1=N[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]2S1 |
| InChI | InChI=1S/C18H32N2O7S/c1-5-6-8-25-9-7-20(17(24)27-18(2,3)4)16-19-12-14(23)13(22)11(10-21)26-15(12)28-16/h11-15,21-23H,5-10H2,1-4H3/t11-,12-,13-,14-,15-/m1/s1 |
| InChIKey | VRPIVMRVCFNQEA-KJWHEZOQSA-N |
| XLogP | 0.95 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|