C15H23F3N2O5S — CID 123194915
tert-butyl N-[6,7-dihydroxy-5-(2,2,2-trifluoroethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate (PubChem CID 123194915) has the molecular formula C15H23F3N2O5S and a molecular weight of 400.42 g/mol. Its IUPAC name is tert-butyl N-[6,7-dihydroxy-5-(2,2,2-trifluoroethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[6,7-dihydroxy-5-(2,2,2-trifluoroethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 123194915 |
| Molecular Formula | C15H23F3N2O5S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | tert-butyl N-[6,7-dihydroxy-5-(2,2,2-trifluoroethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)C1=NC2C(OC(CC(F)(F)F)C(O)C2O)S1 |
| InChI | InChI=1S/C15H23F3N2O5S/c1-5-20(13(23)25-14(2,3)4)12-19-8-10(22)9(21)7(6-15(16,17)18)24-11(8)26-12/h7-11,21-22H,5-6H2,1-4H3 |
| InChIKey | WGDPHLSAWUYJCW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |