C21H31F3N2O6S — CID 118131746
tert-butyl N-[(3aR,5R,6S,7R,7aR)-6,7-bis(prop-2-enoxy)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate (PubChem CID 118131746) has the molecular formula C21H31F3N2O6S and a molecular weight of 496.55 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5R,6S,7R,7aR)-6,7-bis(prop-2-enoxy)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[(3aR,5R,6S,7R,7aR)-6,7-bis(prop-2-enoxy)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 118131746 |
| Molecular Formula | C21H31F3N2O6S |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | tert-butyl N-[(3aR,5R,6S,7R,7aR)-6,7-bis(prop-2-enoxy)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate |
| SMILES | C=CCO[C@@H]1[C@H]2N=C(N(CC)C(=O)OC(C)(C)C)S[C@H]2O[C@H](C(O)C(F)(F)F)[C@H]1OCC=C |
| InChI | InChI=1S/C21H31F3N2O6S/c1-7-10-29-13-12-17(31-15(14(13)30-11-8-2)16(27)21(22,23)24)33-18(25-12)26(9-3)19(28)32-20(4,5)6/h7-8,12-17,27H,1-2,9-11H2,3-6H3/t12-,13-,14+,15+,16?,17-/m1/s1 |
| InChIKey | ZQTPMPBGEGHDFJ-IDGBBOHYSA-N |
| XLogP | 3.51 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|