C28H33F3N2O6S — CID 123802975
tert-butyl N-[6,7-bis(phenylmethoxy)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate (PubChem CID 123802975) has the molecular formula C28H33F3N2O6S and a molecular weight of 582.64 g/mol. Its IUPAC name is tert-butyl N-[6,7-bis(phenylmethoxy)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[6,7-bis(phenylmethoxy)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123802975 |
| Molecular Formula | C28H33F3N2O6S |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | tert-butyl N-[6,7-bis(phenylmethoxy)-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1=NC2C(OC(C(O)C(F)(F)F)C(OCc3ccccc3)C2OCc2ccccc2)S1 |
| InChI | InChI=1S/C28H33F3N2O6S/c1-27(2,3)39-26(35)33(4)25-32-19-20(36-15-17-11-7-5-8-12-17)21(37-16-18-13-9-6-10-14-18)22(38-24(19)40-25)23(34)28(29,30)31/h5-14,19-24,34H,15-16H2,1-4H3 |
| InChIKey | ABEPJHPOXSCZOF-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |