C28H33FN2O6S2 — CID 123454586
tert-butyl N-[(3aR,5R,6R,7S,7aR)-7-fluoro-5-(2-phenoxycarbothioyloxyethyl)-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate (PubChem CID 123454586) has the molecular formula C28H33FN2O6S2 and a molecular weight of 576.71 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5R,6R,7S,7aR)-7-fluoro-5-(2-phenoxycarbothioyloxyethyl)-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3aR,5R,6R,7S,7aR)-7-fluoro-5-(2-phenoxycarbothioyloxyethyl)-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123454586 |
| Molecular Formula | C28H33FN2O6S2 |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | tert-butyl N-[(3aR,5R,6R,7S,7aR)-7-fluoro-5-(2-phenoxycarbothioyloxyethyl)-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1=N[C@@H]2[C@H](F)[C@H](OCc3ccccc3)[C@@H](CCOC(=S)Oc3ccccc3)O[C@@H]2S1 |
| InChI | InChI=1S/C28H33FN2O6S2/c1-28(2,3)37-26(32)31(4)25-30-22-21(29)23(34-17-18-11-7-5-8-12-18)20(36-24(22)39-25)15-16-33-27(38)35-19-13-9-6-10-14-19/h5-14,20-24H,15-17H2,1-4H3/t20-,21+,22-,23-,24-/m1/s1 |
| InChIKey | UVXVMTRTQLDJRM-KEJFTWOCSA-N |
| XLogP | 5.74 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|