C20H25FN2O5S — CID 123381935
tert-butyl N-[(3aR,5S,6S,7R,7aR)-7-fluoro-5-formyl-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate (PubChem CID 123381935) has the molecular formula C20H25FN2O5S and a molecular weight of 424.49 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5S,6S,7R,7aR)-7-fluoro-5-formyl-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3aR,5S,6S,7R,7aR)-7-fluoro-5-formyl-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123381935 |
| Molecular Formula | C20H25FN2O5S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | tert-butyl N-[(3aR,5S,6S,7R,7aR)-7-fluoro-5-formyl-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1=N[C@@H]2[C@@H](F)[C@@H](OCc3ccccc3)[C@@H](C=O)O[C@@H]2S1 |
| InChI | InChI=1S/C20H25FN2O5S/c1-20(2,3)28-19(25)23(4)18-22-15-14(21)16(13(10-24)27-17(15)29-18)26-11-12-8-6-5-7-9-12/h5-10,13-17H,11H2,1-4H3/t13-,14-,15-,16+,17-/m1/s1 |
| InChIKey | CSVMEGRTEGJVFD-OVYGPGRDSA-N |
| XLogP | 3.17 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|