C19H35FN2O5SSi — CID 123531982
tert-butyl N-[(3aR,5R,6S,7R,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-fluoro-6-hydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate (PubChem CID 123531982) has the molecular formula C19H35FN2O5SSi and a molecular weight of 450.65 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5R,6S,7R,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-fluoro-6-hydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(3aR,5R,6S,7R,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-fluoro-6-hydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 123531982 |
| Molecular Formula | C19H35FN2O5SSi |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | tert-butyl N-[(3aR,5R,6S,7R,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-fluoro-6-hydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1=N[C@@H]2[C@@H](F)[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]2S1 |
| InChI | InChI=1S/C19H35FN2O5SSi/c1-18(2,3)27-17(24)22(7)16-21-13-12(20)14(23)11(26-15(13)28-16)10-25-29(8,9)19(4,5)6/h11-15,23H,10H2,1-9H3/t11-,12-,13-,14+,15-/m1/s1 |
| InChIKey | PGACXQGDYVDSOG-ARILJUKYSA-N |
| XLogP | 3.77 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|