C14H19ClN2O6S — CID 90269312
tert-butyl N-[(1R,2R,6R,8S,9S)-8-(chloromethyl)-11-oxo-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-yl]-N-methylcarbamate (PubChem CID 90269312) has the molecular formula C14H19ClN2O6S and a molecular weight of 378.83 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,6R,8S,9S)-8-(chloromethyl)-11-oxo-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1R,2R,6R,8S,9S)-8-(chloromethyl)-11-oxo-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90269312 |
| Molecular Formula | C14H19ClN2O6S |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | tert-butyl N-[(1R,2R,6R,8S,9S)-8-(chloromethyl)-11-oxo-7,10,12-trioxa-5-thia-3-azatricyclo[7.3.0.02,6]dodec-3-en-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1=N[C@@H]2[C@H]3OC(=O)O[C@@H]3[C@@H](CCl)O[C@@H]2S1 |
| InChI | InChI=1S/C14H19ClN2O6S/c1-14(2,3)23-12(18)17(4)11-16-7-9-8(21-13(19)22-9)6(5-15)20-10(7)24-11/h6-10H,5H2,1-4H3/t6-,7-,8-,9-,10-/m1/s1 |
| InChIKey | HHRDPYUHBBZAKR-VVULQXIFSA-N |
| XLogP | 2.19 |
| TPSA | 86.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|