C20H36F2N2O5SSi — CID 67981942
tert-butyl N-[(3aR,5S,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-(difluoromethyl)-6-hydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate (PubChem CID 67981942) has the molecular formula C20H36F2N2O5SSi and a molecular weight of 482.67 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5S,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-(difluoromethyl)-6-hydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[(3aR,5S,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-(difluoromethyl)-6-hydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 67981942 |
| Molecular Formula | C20H36F2N2O5SSi |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | tert-butyl N-[(3aR,5S,6R,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-5-(difluoromethyl)-6-hydroxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)C1=N[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](C(F)F)O[C@@H]2S1 |
| InChI | InChI=1S/C20H36F2N2O5SSi/c1-10-24(18(26)28-19(2,3)4)17-23-11-13(29-31(8,9)20(5,6)7)12(25)14(15(21)22)27-16(11)30-17/h11-16,25H,10H2,1-9H3/t11-,12+,13-,14+,16-/m1/s1 |
| InChIKey | BOODSMTXZRKVSN-YMSVYLFOSA-N |
| XLogP | 4.46 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|