C15H23F3N2O6S — CID 123983921
tert-butyl N-[6,7-dihydroxy-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate (PubChem CID 123983921) has the molecular formula C15H23F3N2O6S and a molecular weight of 416.42 g/mol. Its IUPAC name is tert-butyl N-[6,7-dihydroxy-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[6,7-dihydroxy-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 123983921 |
| Molecular Formula | C15H23F3N2O6S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | tert-butyl N-[6,7-dihydroxy-5-(2,2,2-trifluoro-1-hydroxyethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)C1=NC2C(OC(C(O)C(F)(F)F)C(O)C2O)S1 |
| InChI | InChI=1S/C15H23F3N2O6S/c1-5-20(13(24)26-14(2,3)4)12-19-6-7(21)8(22)9(25-11(6)27-12)10(23)15(16,17)18/h6-11,21-23H,5H2,1-4H3 |
| InChIKey | UPTWCILKCBLYAF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |