C20H36F2N2O5SSi — CID 67982299
[(3aR,5S,6S,7R,7aR)-3a-tert-butyl-7-[tert-butyl(dimethyl)silyl]oxy-5-(difluoromethyl)-6-hydroxy-5,6,7,7a-tetrahydropyrano[3,2-d][1,3]thiazol-2-yl]-ethylcarbamic acid (PubChem CID 67982299) has the molecular formula C20H36F2N2O5SSi and a molecular weight of 482.67 g/mol. Its IUPAC name is [(3aR,5S,6S,7R,7aR)-3a-tert-butyl-7-[tert-butyl(dimethyl)silyl]oxy-5-(difluoromethyl)-6-hydroxy-5,6,7,7a-tetrahydropyrano[3,2-d][1,3]thiazol-2-yl]-ethylcarbamic acid.
| Compound Name | [(3aR,5S,6S,7R,7aR)-3a-tert-butyl-7-[tert-butyl(dimethyl)silyl]oxy-5-(difluoromethyl)-6-hydroxy-5,6,7,7a-tetrahydropyrano[3,2-d][1,3]thiazol-2-yl]-ethylcarbamic acid |
|---|---|
| PubChem CID | 67982299 |
| Molecular Formula | C20H36F2N2O5SSi |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | [(3aR,5S,6S,7R,7aR)-3a-tert-butyl-7-[tert-butyl(dimethyl)silyl]oxy-5-(difluoromethyl)-6-hydroxy-5,6,7,7a-tetrahydropyrano[3,2-d][1,3]thiazol-2-yl]-ethylcarbamic acid |
| SMILES | CCN(C(=O)O)C1=N[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](C(F)F)O[C@]2(C(C)(C)C)S1 |
| InChI | InChI=1S/C20H36F2N2O5SSi/c1-10-24(17(26)27)16-23-14-12(29-31(8,9)19(5,6)7)11(25)13(15(21)22)28-20(14,30-16)18(2,3)4/h11-15,25H,10H2,1-9H3,(H,26,27)/t11-,12+,13+,14-,20+/m1/s1 |
| InChIKey | NJYZZPBBVCAMIC-LXXZJREESA-N |
| XLogP | 4.62 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|