C20H32N2O8S — CID 86701120
tert-butyl N-ethyl-N-[(1R,2R,6R,8S,9S)-8-formyl-11,12-dimethoxy-11,12-dimethyl-7,10,13-trioxa-5-thia-3-azatricyclo[7.4.0.02,6]tridec-3-en-4-yl]carbamate (PubChem CID 86701120) has the molecular formula C20H32N2O8S and a molecular weight of 460.55 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[(1R,2R,6R,8S,9S)-8-formyl-11,12-dimethoxy-11,12-dimethyl-7,10,13-trioxa-5-thia-3-azatricyclo[7.4.0.02,6]tridec-3-en-4-yl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[(1R,2R,6R,8S,9S)-8-formyl-11,12-dimethoxy-11,12-dimethyl-7,10,13-trioxa-5-thia-3-azatricyclo[7.4.0.02,6]tridec-3-en-4-yl]carbamate |
|---|---|
| PubChem CID | 86701120 |
| Molecular Formula | C20H32N2O8S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | tert-butyl N-ethyl-N-[(1R,2R,6R,8S,9S)-8-formyl-11,12-dimethoxy-11,12-dimethyl-7,10,13-trioxa-5-thia-3-azatricyclo[7.4.0.02,6]tridec-3-en-4-yl]carbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)C1=N[C@@H]2[C@H]3OC(C)(OC)C(C)(OC)O[C@@H]3[C@@H](C=O)O[C@@H]2S1 |
| InChI | InChI=1S/C20H32N2O8S/c1-9-22(17(24)30-18(2,3)4)16-21-12-14-13(11(10-23)27-15(12)31-16)28-19(5,25-7)20(6,26-8)29-14/h10-15H,9H2,1-8H3/t11-,12-,13-,14-,15-,19?,20?/m1/s1 |
| InChIKey | SSQMCBUTDHDIDZ-MSOZVEOGSA-N |
| XLogP | 2.15 |
| TPSA | 105.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|