C17H21FN2O5S — CID 71152408
[(3aR,5R,6R,7R,7aR)-7-fluoro-5-(1-hydroxyethyl)-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-methylcarbamic acid (PubChem CID 71152408) has the molecular formula C17H21FN2O5S and a molecular weight of 384.43 g/mol. Its IUPAC name is [(3aR,5R,6R,7R,7aR)-7-fluoro-5-(1-hydroxyethyl)-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-methylcarbamic acid.
| Compound Name | [(3aR,5R,6R,7R,7aR)-7-fluoro-5-(1-hydroxyethyl)-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-methylcarbamic acid |
|---|---|
| PubChem CID | 71152408 |
| Molecular Formula | C17H21FN2O5S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(3aR,5R,6R,7R,7aR)-7-fluoro-5-(1-hydroxyethyl)-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-methylcarbamic acid |
| SMILES | CC(O)[C@H]1O[C@@H]2SC(N(C)C(=O)O)=N[C@@H]2[C@@H](F)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C17H21FN2O5S/c1-9(21)13-14(24-8-10-6-4-3-5-7-10)11(18)12-15(25-13)26-16(19-12)20(2)17(22)23/h3-7,9,11-15,21H,8H2,1-2H3,(H,22,23)/t9?,11-,12-,13-,14+,15-/m1/s1 |
| InChIKey | SWBAKPJKKSDOCT-DNEYJCCBSA-N |
| XLogP | 2.10 |
| TPSA | 91.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |