C31H34F2N2O4S — CID 69086109
(3aR,5S,6S,7R,7aR)-5-[(1R)-2,2-difluoro-1-phenylmethoxyethyl]-N,N-dimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine (PubChem CID 69086109) has the molecular formula C31H34F2N2O4S and a molecular weight of 568.69 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-5-[(1R)-2,2-difluoro-1-phenylmethoxyethyl]-N,N-dimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine.
| Compound Name | (3aR,5S,6S,7R,7aR)-5-[(1R)-2,2-difluoro-1-phenylmethoxyethyl]-N,N-dimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 69086109 |
| Molecular Formula | C31H34F2N2O4S |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-5-[(1R)-2,2-difluoro-1-phenylmethoxyethyl]-N,N-dimethyl-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine |
| SMILES | CN(C)C1=N[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]([C@@H](OCc3ccccc3)C(F)F)O[C@@H]2S1 |
| InChI | InChI=1S/C31H34F2N2O4S/c1-35(2)31-34-24-25(36-18-21-12-6-3-7-13-21)26(37-19-22-14-8-4-9-15-22)27(39-30(24)40-31)28(29(32)33)38-20-23-16-10-5-11-17-23/h3-17,24-30H,18-20H2,1-2H3/t24-,25-,26+,27+,28-,30-/m1/s1 |
| InChIKey | OVZCSABOASGSEI-YLPWQRRJSA-N |
| XLogP | 5.77 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |