C18H33FN2O3S — CID 69280808
(3aR,5R,6R,7R,7aR)-6,7-dibutoxy-5-(2-fluoroethyl)-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine (PubChem CID 69280808) has the molecular formula C18H33FN2O3S and a molecular weight of 376.54 g/mol. Its IUPAC name is (3aR,5R,6R,7R,7aR)-6,7-dibutoxy-5-(2-fluoroethyl)-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine.
| Compound Name | (3aR,5R,6R,7R,7aR)-6,7-dibutoxy-5-(2-fluoroethyl)-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine |
|---|---|
| PubChem CID | 69280808 |
| Molecular Formula | C18H33FN2O3S |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (3aR,5R,6R,7R,7aR)-6,7-dibutoxy-5-(2-fluoroethyl)-N,N-dimethyl-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-amine |
| SMILES | CCCCO[C@@H]1[C@H]2N=C(N(C)C)S[C@H]2O[C@H](CCF)[C@H]1OCCCC |
| InChI | InChI=1S/C18H33FN2O3S/c1-5-7-11-22-15-13(9-10-19)24-17-14(16(15)23-12-8-6-2)20-18(25-17)21(3)4/h13-17H,5-12H2,1-4H3/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | UYYGLPBAXINDQR-WRQOLXDDSA-N |
| XLogP | 3.47 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|