C18H32N2O4S — CID 118131750
1-[(3aR,5S,6S,7R,7aR)-6,7-dibutoxy-2-(dimethylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone (PubChem CID 118131750) has the molecular formula C18H32N2O4S and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,7R,7aR)-6,7-dibutoxy-2-(dimethylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone.
| Compound Name | 1-[(3aR,5S,6S,7R,7aR)-6,7-dibutoxy-2-(dimethylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 118131750 |
| Molecular Formula | C18H32N2O4S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1-[(3aR,5S,6S,7R,7aR)-6,7-dibutoxy-2-(dimethylamino)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone |
| SMILES | CCCCO[C@@H]1[C@H]2N=C(N(C)C)S[C@H]2O[C@H](C(C)=O)[C@H]1OCCCC |
| InChI | InChI=1S/C18H32N2O4S/c1-6-8-10-22-15-13-17(25-18(19-13)20(4)5)24-14(12(3)21)16(15)23-11-9-7-2/h13-17H,6-11H2,1-5H3/t13-,14-,15-,16-,17-/m1/s1 |
| InChIKey | KUTKBNPZHWORKY-WRQOLXDDSA-N |
| XLogP | 2.70 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|