C25H27BrN2O4S — CID 163709712
1-[(3aR,5S,6S,7R,7aR)-2-[bromo(prop-2-enyl)amino]-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone (PubChem CID 163709712) has the molecular formula C25H27BrN2O4S and a molecular weight of 531.47 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,7R,7aR)-2-[bromo(prop-2-enyl)amino]-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone.
| Compound Name | 1-[(3aR,5S,6S,7R,7aR)-2-[bromo(prop-2-enyl)amino]-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 163709712 |
| Molecular Formula | C25H27BrN2O4S |
| Molecular Weight | 531.47 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | 1-[(3aR,5S,6S,7R,7aR)-2-[bromo(prop-2-enyl)amino]-6,7-bis(phenylmethoxy)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone |
| SMILES | C=CCN(Br)C1=N[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](C(C)=O)O[C@@H]2S1 |
| InChI | InChI=1S/C25H27BrN2O4S/c1-3-14-28(26)25-27-20-22(30-15-18-10-6-4-7-11-18)23(21(17(2)29)32-24(20)33-25)31-16-19-12-8-5-9-13-19/h3-13,20-24H,1,14-16H2,2H3/t20-,21-,22-,23-,24-/m1/s1 |
| InChIKey | KIDCXOLUCOAVCJ-MRKXFKPJSA-N |
| XLogP | 4.74 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|