C26H32N2O6S — CID 69082386
1-[(3aR,5S,6S,7R,7aR)-2-(dimethylamino)-6,7-bis[(4-methoxyphenyl)methoxy]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone (PubChem CID 69082386) has the molecular formula C26H32N2O6S and a molecular weight of 500.62 g/mol. Its IUPAC name is 1-[(3aR,5S,6S,7R,7aR)-2-(dimethylamino)-6,7-bis[(4-methoxyphenyl)methoxy]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone.
| Compound Name | 1-[(3aR,5S,6S,7R,7aR)-2-(dimethylamino)-6,7-bis[(4-methoxyphenyl)methoxy]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 69082386 |
| Molecular Formula | C26H32N2O6S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 1-[(3aR,5S,6S,7R,7aR)-2-(dimethylamino)-6,7-bis[(4-methoxyphenyl)methoxy]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-5-yl]ethanone |
| SMILES | COc1ccc(CO[C@@H]2[C@H]3N=C(N(C)C)S[C@H]3O[C@H](C(C)=O)[C@H]2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H32N2O6S/c1-16(29)22-24(33-15-18-8-12-20(31-5)13-9-18)23(21-25(34-22)35-26(27-21)28(2)3)32-14-17-6-10-19(30-4)11-7-17/h6-13,21-25H,14-15H2,1-5H3/t21-,22-,23-,24-,25-/m1/s1 |
| InChIKey | GZTFCPBBMMQFRW-FXEFVXDJSA-N |
| XLogP | 3.52 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |