C18H26N2O5S — CID 118122829
(3aR,5S,6S,7R,7aR)-2-(dimethylamino)-5-[(1R)-1-[(4-methoxyphenyl)methoxy]ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 118122829) has the molecular formula C18H26N2O5S and a molecular weight of 382.48 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-2-(dimethylamino)-5-[(1R)-1-[(4-methoxyphenyl)methoxy]ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | (3aR,5S,6S,7R,7aR)-2-(dimethylamino)-5-[(1R)-1-[(4-methoxyphenyl)methoxy]ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 118122829 |
| Molecular Formula | C18H26N2O5S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-2-(dimethylamino)-5-[(1R)-1-[(4-methoxyphenyl)methoxy]ethyl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | COc1ccc(CO[C@H](C)[C@H]2O[C@@H]3SC(N(C)C)=N[C@@H]3[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C18H26N2O5S/c1-10(24-9-11-5-7-12(23-4)8-6-11)16-15(22)14(21)13-17(25-16)26-18(19-13)20(2)3/h5-8,10,13-17,21-22H,9H2,1-4H3/t10-,13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | UTHGPKRNEQMAKW-NBYNOWDBSA-N |
| XLogP | 1.08 |
| TPSA | 83.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |