C19H28N2O4S — CID 123941562
2-(dimethylamino)-5-[4-(4-methoxyphenyl)butan-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol (PubChem CID 123941562) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-(dimethylamino)-5-[4-(4-methoxyphenyl)butan-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol.
| Compound Name | 2-(dimethylamino)-5-[4-(4-methoxyphenyl)butan-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
|---|---|
| PubChem CID | 123941562 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-(dimethylamino)-5-[4-(4-methoxyphenyl)butan-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazole-6,7-diol |
| SMILES | COc1ccc(CCC(C)C2OC3SC(N(C)C)=NC3C(O)C2O)cc1 |
| InChI | InChI=1S/C19H28N2O4S/c1-11(5-6-12-7-9-13(24-4)10-8-12)17-16(23)15(22)14-18(25-17)26-19(20-14)21(2)3/h7-11,14-18,22-23H,5-6H2,1-4H3 |
| InChIKey | BYNKWMGJAPOGKR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 74.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |