C19H25F3N2O3S — CID 144662338
(3aR,5S,7S,7aR)-2-(dimethylamino)-5-[(2R)-1,1,1-trifluoro-4-(4-methoxyphenyl)butan-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-7-ol (PubChem CID 144662338) has the molecular formula C19H25F3N2O3S and a molecular weight of 418.48 g/mol. Its IUPAC name is (3aR,5S,7S,7aR)-2-(dimethylamino)-5-[(2R)-1,1,1-trifluoro-4-(4-methoxyphenyl)butan-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-7-ol.
| Compound Name | (3aR,5S,7S,7aR)-2-(dimethylamino)-5-[(2R)-1,1,1-trifluoro-4-(4-methoxyphenyl)butan-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-7-ol |
|---|---|
| PubChem CID | 144662338 |
| Molecular Formula | C19H25F3N2O3S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (3aR,5S,7S,7aR)-2-(dimethylamino)-5-[(2R)-1,1,1-trifluoro-4-(4-methoxyphenyl)butan-2-yl]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-7-ol |
| SMILES | COc1ccc(CC[C@H]([C@@H]2C[C@H](O)[C@H]3N=C(N(C)C)S[C@H]3O2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H25F3N2O3S/c1-24(2)18-23-16-14(25)10-15(27-17(16)28-18)13(19(20,21)22)9-6-11-4-7-12(26-3)8-5-11/h4-5,7-8,13-17,25H,6,9-10H2,1-3H3/t13-,14+,15+,16-,17-/m1/s1 |
| InChIKey | WQULHWURNJHFIT-DRRXZNNHSA-N |
| XLogP | 3.32 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |