C38H48N2O9S — CID 69085612
tert-butyl N-[(3aR,5R,6S,7R,7aR)-5-(2-hydroxyethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-(2-phenylmethoxyethyl)carbamate (PubChem CID 69085612) has the molecular formula C38H48N2O9S and a molecular weight of 708.87 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5R,6S,7R,7aR)-5-(2-hydroxyethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-(2-phenylmethoxyethyl)carbamate.
| Compound Name | tert-butyl N-[(3aR,5R,6S,7R,7aR)-5-(2-hydroxyethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-(2-phenylmethoxyethyl)carbamate |
|---|---|
| PubChem CID | 69085612 |
| Molecular Formula | C38H48N2O9S |
| Molecular Weight | 708.87 g/mol |
| Exact Mass | 708.31 |
| IUPAC Name | tert-butyl N-[(3aR,5R,6S,7R,7aR)-5-(2-hydroxyethyl)-6,7-bis[(4-methoxyphenyl)methoxy]-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-(2-phenylmethoxyethyl)carbamate |
| SMILES | COc1ccc(CO[C@@H]2[C@H]3N=C(N(CCOCc4ccccc4)C(=O)OC(C)(C)C)S[C@H]3O[C@H](CCO)[C@@H]2OCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H48N2O9S/c1-38(2,3)49-37(42)40(20-22-45-23-26-9-7-6-8-10-26)36-39-32-34(47-25-28-13-17-30(44-5)18-14-28)33(31(19-21-41)48-35(32)50-36)46-24-27-11-15-29(43-4)16-12-27/h6-18,31-35,41H,19-25H2,1-5H3/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | UBXGWUCGHWNGBT-CKQPALCZSA-N |
| XLogP | 6.21 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.87 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|