C27H44N2O5SSi — CID 123269109
tert-butyl N-[(3aR,5R,6S,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate (PubChem CID 123269109) has the molecular formula C27H44N2O5SSi and a molecular weight of 536.81 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5R,6S,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate.
| Compound Name | tert-butyl N-[(3aR,5R,6S,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 123269109 |
| Molecular Formula | C27H44N2O5SSi |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | tert-butyl N-[(3aR,5R,6S,7aR)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-phenylmethoxy-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]thiazol-2-yl]-N-ethylcarbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)C1=N[C@@H]2C[C@H](OCc3ccccc3)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H]2S1 |
| InChI | InChI=1S/C27H44N2O5SSi/c1-10-29(25(30)34-26(2,3)4)24-28-20-16-21(31-17-19-14-12-11-13-15-19)22(33-23(20)35-24)18-32-36(8,9)27(5,6)7/h11-15,20-23H,10,16-18H2,1-9H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | DMNMXRSEFXSSPK-KAOXLYBCSA-N |
| XLogP | 6.44 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|