C15H15ClN6O — CID 69281716
N-[1-(4-aminophenyl)-3-methylpyrazol-4-yl]-5-chloro-4-methoxypyrimidin-2-amine (PubChem CID 69281716) has the molecular formula C15H15ClN6O and a molecular weight of 330.78 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)-3-methylpyrazol-4-yl]-5-chloro-4-methoxypyrimidin-2-amine.
| Compound Name | N-[1-(4-aminophenyl)-3-methylpyrazol-4-yl]-5-chloro-4-methoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 69281716 |
| Molecular Formula | C15H15ClN6O |
| Molecular Weight | 330.78 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[1-(4-aminophenyl)-3-methylpyrazol-4-yl]-5-chloro-4-methoxypyrimidin-2-amine |
| SMILES | COc1nc(Nc2cn(-c3ccc(N)cc3)nc2C)ncc1Cl |
| InChI | InChI=1S/C15H15ClN6O/c1-9-13(19-15-18-7-12(16)14(20-15)23-2)8-22(21-9)11-5-3-10(17)4-6-11/h3-8H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | BRPUGWSUQBSUGX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|