C19H14NO3S- — CID 6928280
8-[2-(methylcarbamoyl)phenyl]sulfanylnaphthalene-1-carboxylate (PubChem CID 6928280) has the molecular formula C19H14NO3S- and a molecular weight of 336.39 g/mol. Its IUPAC name is 8-[2-(methylcarbamoyl)phenyl]sulfanylnaphthalene-1-carboxylate.
| Compound Name | 8-[2-(methylcarbamoyl)phenyl]sulfanylnaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 6928280 |
| Molecular Formula | C19H14NO3S- |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 8-[2-(methylcarbamoyl)phenyl]sulfanylnaphthalene-1-carboxylate |
| SMILES | CNC(=O)c1ccccc1Sc1cccc2cccc(C(=O)[O-])c12 |
| InChI | InChI=1S/C19H15NO3S/c1-20-18(21)13-8-2-3-10-15(13)24-16-11-5-7-12-6-4-9-14(17(12)16)19(22)23/h2-11H,1H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | VJDDYENQXYSZIF-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |