C16H16N2O2S2 — CID 169439235
N-(trideuteriomethyl)-2-[[2-(trideuteriomethylcarbamoyl)phenyl]disulfanyl]benzamide (PubChem CID 169439235) has the molecular formula C16H16N2O2S2 and a molecular weight of 338.49 g/mol. Its IUPAC name is N-(trideuteriomethyl)-2-[[2-(trideuteriomethylcarbamoyl)phenyl]disulfanyl]benzamide.
| Compound Name | N-(trideuteriomethyl)-2-[[2-(trideuteriomethylcarbamoyl)phenyl]disulfanyl]benzamide |
|---|---|
| PubChem CID | 169439235 |
| Molecular Formula | C16H16N2O2S2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-(trideuteriomethyl)-2-[[2-(trideuteriomethylcarbamoyl)phenyl]disulfanyl]benzamide |
| SMILES | [2H]C([2H])([2H])NC(=O)c1ccccc1SSc1ccccc1C(=O)NC([2H])([2H])[2H] |
| InChI | InChI=1S/C16H16N2O2S2/c1-17-15(19)11-7-3-5-9-13(11)21-22-14-10-6-4-8-12(14)16(20)18-2/h3-10H,1-2H3,(H,17,19)(H,18,20)/i1D3,2D3 |
| InChIKey | JEVCLNJEBFWVPD-WFGJKAKNSA-N |
| XLogP | 3.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|