4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid

C8H10O4S2 — CID 69294725

IUPAC4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid
SMILESCSC1(C(=O)O)CSC2C(C(=O)O)C21
InChIInChI=1S/C8H10O4S2/c1-13-8(7(11)12)2-14-5-3(4(5)8)6(9)10/h3-5H,2H2,1H3,(H,9,10)(H,11,12)
InChIKeyFEPYJNRULAVVJZ-UHFFFAOYSA-N
MW234.30 g/mol
LogP0.62
Rot. Bonds3

About 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid

4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid (PubChem CID 69294725) has the molecular formula C8H10O4S2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid.

Molecular Properties

Compound Name4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid
PubChem CID69294725
Molecular FormulaC8H10O4S2
Molecular Weight234.30 g/mol
Exact Mass234.00
IUPAC Name4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid
SMILESCSC1(C(=O)O)CSC2C(C(=O)O)C21
InChIInChI=1S/C8H10O4S2/c1-13-8(7(11)12)2-14-5-3(4(5)8)6(9)10/h3-5H,2H2,1H3,(H,9,10)(H,11,12)
InChIKeyFEPYJNRULAVVJZ-UHFFFAOYSA-N
XLogP0.62
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.30
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid?
The IUPAC name of 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid (CID 69294725) is 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid.
What is the SMILES notation for 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid?
The canonical SMILES for 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid is CSC1(C(=O)O)CSC2C(C(=O)O)C21.
What is the InChIKey of 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid?
The InChIKey is FEPYJNRULAVVJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4S2/c1-13-8(7(11)12)2-14-5-3(4(5)8)6(9)10/h3-5H,2H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid?
4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid has a molecular weight of 234.30 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanyl-2-thiabicyclo[3.1.0]hexane-4,6-dicarboxylic acid is sourced from PubChem (CID 69294725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).