C42H38N2O6S2 — CID 69294859
3-(4-aminophenyl)sulfonyl-1,3-diphenylpropan-1-one (PubChem CID 69294859) has the molecular formula C42H38N2O6S2 and a molecular weight of 730.91 g/mol. Its IUPAC name is 3-(4-aminophenyl)sulfonyl-1,3-diphenylpropan-1-one.
| Compound Name | 3-(4-aminophenyl)sulfonyl-1,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 69294859 |
| Molecular Formula | C42H38N2O6S2 |
| Molecular Weight | 730.91 g/mol |
| Exact Mass | 730.22 |
| IUPAC Name | 3-(4-aminophenyl)sulfonyl-1,3-diphenylpropan-1-one |
| SMILES | Nc1ccc(S(=O)(=O)C(CC(=O)c2ccccc2)c2ccccc2)cc1.Nc1ccc(S(=O)(=O)C(CC(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C21H19NO3S/c2*22-18-11-13-19(14-12-18)26(24,25)21(17-9-5-2-6-10-17)15-20(23)16-7-3-1-4-8-16/h2*1-14,21H,15,22H2 |
| InChIKey | XEXQEGCGCLCENA-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.91 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|