C13H19ClF3N3 — CID 69295771
5-chloro-1-methyl-4-[(3-propylpyrrolidin-1-yl)methyl]-3-(trifluoromethyl)pyrazole (PubChem CID 69295771) has the molecular formula C13H19ClF3N3 and a molecular weight of 309.76 g/mol. Its IUPAC name is 5-chloro-1-methyl-4-[(3-propylpyrrolidin-1-yl)methyl]-3-(trifluoromethyl)pyrazole.
| Compound Name | 5-chloro-1-methyl-4-[(3-propylpyrrolidin-1-yl)methyl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 69295771 |
| Molecular Formula | C13H19ClF3N3 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 5-chloro-1-methyl-4-[(3-propylpyrrolidin-1-yl)methyl]-3-(trifluoromethyl)pyrazole |
| SMILES | CCCC1CCN(Cc2c(C(F)(F)F)nn(C)c2Cl)C1 |
| InChI | InChI=1S/C13H19ClF3N3/c1-3-4-9-5-6-20(7-9)8-10-11(13(15,16)17)18-19(2)12(10)14/h9H,3-8H2,1-2H3 |
| InChIKey | YNRLNCSEXPMJNN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |