C20H23N2O4P — CID 69296374
2-[[benzyl(hydroxy)phosphoryl]amino]-4-(1H-indol-3-yl)pentanoic acid (PubChem CID 69296374) has the molecular formula C20H23N2O4P and a molecular weight of 386.39 g/mol. Its IUPAC name is 2-[[benzyl(hydroxy)phosphoryl]amino]-4-(1H-indol-3-yl)pentanoic acid.
| Compound Name | 2-[[benzyl(hydroxy)phosphoryl]amino]-4-(1H-indol-3-yl)pentanoic acid |
|---|---|
| PubChem CID | 69296374 |
| Molecular Formula | C20H23N2O4P |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[[benzyl(hydroxy)phosphoryl]amino]-4-(1H-indol-3-yl)pentanoic acid |
| SMILES | CC(CC(NP(=O)(O)Cc1ccccc1)C(=O)O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H23N2O4P/c1-14(17-12-21-18-10-6-5-9-16(17)18)11-19(20(23)24)22-27(25,26)13-15-7-3-2-4-8-15/h2-10,12,14,19,21H,11,13H2,1H3,(H,23,24)(H2,22,25,26) |
| InChIKey | SFNXLLBVDPZTQK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|