C27H37FN2O4 — CID 69299328
2-[4-(butoxymethyl)-2-methoxyphenoxy]-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 69299328) has the molecular formula C27H37FN2O4 and a molecular weight of 472.60 g/mol. Its IUPAC name is 2-[4-(butoxymethyl)-2-methoxyphenoxy]-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 2-[4-(butoxymethyl)-2-methoxyphenoxy]-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 69299328 |
| Molecular Formula | C27H37FN2O4 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 2-[4-(butoxymethyl)-2-methoxyphenoxy]-1-[(2S,5R)-4-[(4-fluorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | CCCCOCc1ccc(OCC(=O)N2C[C@@H](C)N(Cc3ccc(F)cc3)C[C@@H]2C)c(OC)c1 |
| InChI | InChI=1S/C27H37FN2O4/c1-5-6-13-33-18-23-9-12-25(26(14-23)32-4)34-19-27(31)30-16-20(2)29(15-21(30)3)17-22-7-10-24(28)11-8-22/h7-12,14,20-21H,5-6,13,15-19H2,1-4H3/t20-,21+/m1/s1 |
| InChIKey | HDKWYOOFOZTGFR-RTWAWAEBSA-N |
| XLogP | 4.65 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|