C18H13Cl2N5O — CID 69299546
3-[3-[chloro-(2-chlorophenyl)methoxy]phenyl]-2H-pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 69299546) has the molecular formula C18H13Cl2N5O and a molecular weight of 386.24 g/mol. Its IUPAC name is 3-[3-[chloro-(2-chlorophenyl)methoxy]phenyl]-2H-pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 3-[3-[chloro-(2-chlorophenyl)methoxy]phenyl]-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 69299546 |
| Molecular Formula | C18H13Cl2N5O |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 3-[3-[chloro-(2-chlorophenyl)methoxy]phenyl]-2H-pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2n[nH]c(-c3cccc(OC(Cl)c4ccccc4Cl)c3)c12 |
| InChI | InChI=1S/C18H13Cl2N5O/c19-13-7-2-1-6-12(13)16(20)26-11-5-3-4-10(8-11)15-14-17(21)22-9-23-18(14)25-24-15/h1-9,16H,(H3,21,22,23,24,25) |
| InChIKey | HEHPMZDOMPSEIR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|