C15H13O3S2- — CID 6930231
2-[5-[2-(4-methylphenyl)sulfanylacetyl]thiophen-2-yl]acetate (PubChem CID 6930231) has the molecular formula C15H13O3S2- and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-[5-[2-(4-methylphenyl)sulfanylacetyl]thiophen-2-yl]acetate.
| Compound Name | 2-[5-[2-(4-methylphenyl)sulfanylacetyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 6930231 |
| Molecular Formula | C15H13O3S2- |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 2-[5-[2-(4-methylphenyl)sulfanylacetyl]thiophen-2-yl]acetate |
| SMILES | Cc1ccc(SCC(=O)c2ccc(CC(=O)[O-])s2)cc1 |
| InChI | InChI=1S/C15H14O3S2/c1-10-2-4-11(5-3-10)19-9-13(16)14-7-6-12(20-14)8-15(17)18/h2-7H,8-9H2,1H3,(H,17,18)/p-1 |
| InChIKey | ZMVCRIFYVTXPMQ-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |