C19H21NO4S2 — CID 8673493
2-[5-[2-(4-methoxyphenyl)sulfanylacetyl]thiophen-2-yl]-1-morpholin-4-ylethanone (PubChem CID 8673493) has the molecular formula C19H21NO4S2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-[5-[2-(4-methoxyphenyl)sulfanylacetyl]thiophen-2-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[5-[2-(4-methoxyphenyl)sulfanylacetyl]thiophen-2-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 8673493 |
| Molecular Formula | C19H21NO4S2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-[5-[2-(4-methoxyphenyl)sulfanylacetyl]thiophen-2-yl]-1-morpholin-4-ylethanone |
| SMILES | COc1ccc(SCC(=O)c2ccc(CC(=O)N3CCOCC3)s2)cc1 |
| InChI | InChI=1S/C19H21NO4S2/c1-23-14-2-4-15(5-3-14)25-13-17(21)18-7-6-16(26-18)12-19(22)20-8-10-24-11-9-20/h2-7H,8-13H2,1H3 |
| InChIKey | JKQLLMAACYEGFH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |