C20H21NO6S — CID 7488735
[2-[5-(2-morpholin-4-yl-2-oxoethyl)thiophen-2-yl]-2-oxoethyl] 4-(hydroxymethyl)benzoate (PubChem CID 7488735) has the molecular formula C20H21NO6S and a molecular weight of 403.46 g/mol. Its IUPAC name is [2-[5-(2-morpholin-4-yl-2-oxoethyl)thiophen-2-yl]-2-oxoethyl] 4-(hydroxymethyl)benzoate.
| Compound Name | [2-[5-(2-morpholin-4-yl-2-oxoethyl)thiophen-2-yl]-2-oxoethyl] 4-(hydroxymethyl)benzoate |
|---|---|
| PubChem CID | 7488735 |
| Molecular Formula | C20H21NO6S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | [2-[5-(2-morpholin-4-yl-2-oxoethyl)thiophen-2-yl]-2-oxoethyl] 4-(hydroxymethyl)benzoate |
| SMILES | O=C(OCC(=O)c1ccc(CC(=O)N2CCOCC2)s1)c1ccc(CO)cc1 |
| InChI | InChI=1S/C20H21NO6S/c22-12-14-1-3-15(4-2-14)20(25)27-13-17(23)18-6-5-16(28-18)11-19(24)21-7-9-26-10-8-21/h1-6,22H,7-13H2 |
| InChIKey | URFSGODJQQOODH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |