C20H20FNO5S — CID 9387099
[2-[5-(2-morpholin-4-yl-2-oxoethyl)thiophen-2-yl]-2-oxoethyl] 3-fluoro-4-methylbenzoate (PubChem CID 9387099) has the molecular formula C20H20FNO5S and a molecular weight of 405.45 g/mol. Its IUPAC name is [2-[5-(2-morpholin-4-yl-2-oxoethyl)thiophen-2-yl]-2-oxoethyl] 3-fluoro-4-methylbenzoate.
| Compound Name | [2-[5-(2-morpholin-4-yl-2-oxoethyl)thiophen-2-yl]-2-oxoethyl] 3-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 9387099 |
| Molecular Formula | C20H20FNO5S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | [2-[5-(2-morpholin-4-yl-2-oxoethyl)thiophen-2-yl]-2-oxoethyl] 3-fluoro-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)c2ccc(CC(=O)N3CCOCC3)s2)cc1F |
| InChI | InChI=1S/C20H20FNO5S/c1-13-2-3-14(10-16(13)21)20(25)27-12-17(23)18-5-4-15(28-18)11-19(24)22-6-8-26-9-7-22/h2-5,10H,6-9,11-12H2,1H3 |
| InChIKey | IVYFTQJOANKLAM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |