C18H24FN3O4S — CID 55545871
3-fluoro-4-methyl-N-[2-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]ethyl]benzamide (PubChem CID 55545871) has the molecular formula C18H24FN3O4S and a molecular weight of 397.47 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-[2-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]ethyl]benzamide.
| Compound Name | 3-fluoro-4-methyl-N-[2-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55545871 |
| Molecular Formula | C18H24FN3O4S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 3-fluoro-4-methyl-N-[2-[[2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetyl]amino]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)CSCC(=O)N2CCOCC2)cc1F |
| InChI | InChI=1S/C18H24FN3O4S/c1-13-2-3-14(10-15(13)19)18(25)21-5-4-20-16(23)11-27-12-17(24)22-6-8-26-9-7-22/h2-3,10H,4-9,11-12H2,1H3,(H,20,23)(H,21,25) |
| InChIKey | IVXAEQDXHKBXPD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|