C16H19FN4O3S — CID 55793071
3-fluoro-4-methyl-N-[2-[[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]acetyl]amino]ethyl]benzamide (PubChem CID 55793071) has the molecular formula C16H19FN4O3S and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-[2-[[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]acetyl]amino]ethyl]benzamide.
| Compound Name | 3-fluoro-4-methyl-N-[2-[[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 55793071 |
| Molecular Formula | C16H19FN4O3S |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-fluoro-4-methyl-N-[2-[[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylsulfanyl]acetyl]amino]ethyl]benzamide |
| SMILES | Cc1nc(CSCC(=O)NCCNC(=O)c2ccc(C)c(F)c2)no1 |
| InChI | InChI=1S/C16H19FN4O3S/c1-10-3-4-12(7-13(10)17)16(23)19-6-5-18-15(22)9-25-8-14-20-11(2)24-21-14/h3-4,7H,5-6,8-9H2,1-2H3,(H,18,22)(H,19,23) |
| InChIKey | GHKBYQLYTREUHN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|