C11H7ClNO3S- — CID 6930328
2-[(5R)-2-(3-chlorophenyl)-4-oxo-1,3-thiazol-5-yl]acetate (PubChem CID 6930328) has the molecular formula C11H7ClNO3S- and a molecular weight of 268.70 g/mol. Its IUPAC name is 2-[(5R)-2-(3-chlorophenyl)-4-oxo-1,3-thiazol-5-yl]acetate.
| Compound Name | 2-[(5R)-2-(3-chlorophenyl)-4-oxo-1,3-thiazol-5-yl]acetate |
|---|---|
| PubChem CID | 6930328 |
| Molecular Formula | C11H7ClNO3S- |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 2-[(5R)-2-(3-chlorophenyl)-4-oxo-1,3-thiazol-5-yl]acetate |
| SMILES | O=C([O-])C[C@H]1SC(c2cccc(Cl)c2)=NC1=O |
| InChI | InChI=1S/C11H8ClNO3S/c12-7-3-1-2-6(4-7)11-13-10(16)8(17-11)5-9(14)15/h1-4,8H,5H2,(H,14,15)/p-1/t8-/m1/s1 |
| InChIKey | FHLYYJKNYWPGNE-MRVPVSSYSA-M |
| XLogP | 0.87 |
| TPSA | 69.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |