C18H15ClN2O3 — CID 69307133
[1-(5-chloro-8-hydroxyquinolin-7-yl)-2-phenylethyl]carbamic acid (PubChem CID 69307133) has the molecular formula C18H15ClN2O3 and a molecular weight of 342.78 g/mol. Its IUPAC name is [1-(5-chloro-8-hydroxyquinolin-7-yl)-2-phenylethyl]carbamic acid.
| Compound Name | [1-(5-chloro-8-hydroxyquinolin-7-yl)-2-phenylethyl]carbamic acid |
|---|---|
| PubChem CID | 69307133 |
| Molecular Formula | C18H15ClN2O3 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | [1-(5-chloro-8-hydroxyquinolin-7-yl)-2-phenylethyl]carbamic acid |
| SMILES | O=C(O)NC(Cc1ccccc1)c1cc(Cl)c2cccnc2c1O |
| InChI | InChI=1S/C18H15ClN2O3/c19-14-10-13(17(22)16-12(14)7-4-8-20-16)15(21-18(23)24)9-11-5-2-1-3-6-11/h1-8,10,15,21-22H,9H2,(H,23,24) |
| InChIKey | IBZFYQSAEZSLFQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|