C29H22N4O6 — CID 69311613
[4-[1-(methylcarbamoyl)indol-6-yl]oxy-2-pyridinyl]-(2-phenylphenoxy)carbonylcarbamic acid (PubChem CID 69311613) has the molecular formula C29H22N4O6 and a molecular weight of 522.52 g/mol. Its IUPAC name is [4-[1-(methylcarbamoyl)indol-6-yl]oxy-2-pyridinyl]-(2-phenylphenoxy)carbonylcarbamic acid.
| Compound Name | [4-[1-(methylcarbamoyl)indol-6-yl]oxy-2-pyridinyl]-(2-phenylphenoxy)carbonylcarbamic acid |
|---|---|
| PubChem CID | 69311613 |
| Molecular Formula | C29H22N4O6 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | [4-[1-(methylcarbamoyl)indol-6-yl]oxy-2-pyridinyl]-(2-phenylphenoxy)carbonylcarbamic acid |
| SMILES | CNC(=O)n1ccc2ccc(Oc3ccnc(N(C(=O)O)C(=O)Oc4ccccc4-c4ccccc4)c3)cc21 |
| InChI | InChI=1S/C29H22N4O6/c1-30-27(34)32-16-14-20-11-12-21(17-24(20)32)38-22-13-15-31-26(18-22)33(28(35)36)29(37)39-25-10-6-5-9-23(25)19-7-3-2-4-8-19/h2-18H,1H3,(H,30,34)(H,35,36) |
| InChIKey | QBCFPDVYRQEMQN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |