C23H26O4 — CID 69312280
ethyl 2-[4-phenylmethoxy-2,6-bis(prop-2-enyl)phenoxy]acetate (PubChem CID 69312280) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is ethyl 2-[4-phenylmethoxy-2,6-bis(prop-2-enyl)phenoxy]acetate.
| Compound Name | ethyl 2-[4-phenylmethoxy-2,6-bis(prop-2-enyl)phenoxy]acetate |
|---|---|
| PubChem CID | 69312280 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | ethyl 2-[4-phenylmethoxy-2,6-bis(prop-2-enyl)phenoxy]acetate |
| SMILES | C=CCc1cc(OCc2ccccc2)cc(CC=C)c1OCC(=O)OCC |
| InChI | InChI=1S/C23H26O4/c1-4-10-19-14-21(26-16-18-12-8-7-9-13-18)15-20(11-5-2)23(19)27-17-22(24)25-6-3/h4-5,7-9,12-15H,1-2,6,10-11,16-17H2,3H3 |
| InChIKey | UHVCMIIXDKDVPA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|