C20H18Cl2IN3O4 — CID 69312318
2-cyano-N-(2,4-dichloro-5-methoxyphenyl)-3-[3-iodo-4-(2-methoxyethoxy)anilino]prop-2-enamide (PubChem CID 69312318) has the molecular formula C20H18Cl2IN3O4 and a molecular weight of 562.19 g/mol. Its IUPAC name is 2-cyano-N-(2,4-dichloro-5-methoxyphenyl)-3-[3-iodo-4-(2-methoxyethoxy)anilino]prop-2-enamide.
| Compound Name | 2-cyano-N-(2,4-dichloro-5-methoxyphenyl)-3-[3-iodo-4-(2-methoxyethoxy)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 69312318 |
| Molecular Formula | C20H18Cl2IN3O4 |
| Molecular Weight | 562.19 g/mol |
| Exact Mass | 560.97 |
| IUPAC Name | 2-cyano-N-(2,4-dichloro-5-methoxyphenyl)-3-[3-iodo-4-(2-methoxyethoxy)anilino]prop-2-enamide |
| SMILES | COCCOc1ccc(NC=C(C#N)C(=O)Nc2cc(OC)c(Cl)cc2Cl)cc1I |
| InChI | InChI=1S/C20H18Cl2IN3O4/c1-28-5-6-30-18-4-3-13(7-16(18)23)25-11-12(10-24)20(27)26-17-9-19(29-2)15(22)8-14(17)21/h3-4,7-9,11,25H,5-6H2,1-2H3,(H,26,27) |
| InChIKey | CVFMTTCWJQZTSI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.19 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|