C19H23N3 — CID 69314160
4-(5-phenyl-3-pyridinyl)-1,4-diazabicyclo[3.3.2]decane (PubChem CID 69314160) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-(5-phenyl-3-pyridinyl)-1,4-diazabicyclo[3.3.2]decane.
| Compound Name | 4-(5-phenyl-3-pyridinyl)-1,4-diazabicyclo[3.3.2]decane |
|---|---|
| PubChem CID | 69314160 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 4-(5-phenyl-3-pyridinyl)-1,4-diazabicyclo[3.3.2]decane |
| SMILES | c1ccc(-c2cncc(N3CCN4CCCC3CC4)c2)cc1 |
| InChI | InChI=1S/C19H23N3/c1-2-5-16(6-3-1)17-13-19(15-20-14-17)22-12-11-21-9-4-7-18(22)8-10-21/h1-3,5-6,13-15,18H,4,7-12H2 |
| InChIKey | LISJKWUCPNWEOC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |