C13H19N3 — CID 69315328
4-pyridin-2-yl-1,4-diazabicyclo[3.3.2]decane (PubChem CID 69315328) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-pyridin-2-yl-1,4-diazabicyclo[3.3.2]decane.
| Compound Name | 4-pyridin-2-yl-1,4-diazabicyclo[3.3.2]decane |
|---|---|
| PubChem CID | 69315328 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4-pyridin-2-yl-1,4-diazabicyclo[3.3.2]decane |
| SMILES | c1ccc(N2CCN3CCCC2CC3)nc1 |
| InChI | InChI=1S/C13H19N3/c1-2-7-14-13(5-1)16-11-10-15-8-3-4-12(16)6-9-15/h1-2,5,7,12H,3-4,6,8-11H2 |
| InChIKey | GATSHDMHXNTLRV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |