C26H30Cl2N2O5 — CID 69318287
3-[3-[3-[3-[(2,4-dichlorophenoxy)methyl]-5-propan-2-yloxyphenyl]propoxy]-1-methylpyrazol-5-yl]propanoic acid (PubChem CID 69318287) has the molecular formula C26H30Cl2N2O5 and a molecular weight of 521.44 g/mol. Its IUPAC name is 3-[3-[3-[3-[(2,4-dichlorophenoxy)methyl]-5-propan-2-yloxyphenyl]propoxy]-1-methylpyrazol-5-yl]propanoic acid.
| Compound Name | 3-[3-[3-[3-[(2,4-dichlorophenoxy)methyl]-5-propan-2-yloxyphenyl]propoxy]-1-methylpyrazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 69318287 |
| Molecular Formula | C26H30Cl2N2O5 |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 3-[3-[3-[3-[(2,4-dichlorophenoxy)methyl]-5-propan-2-yloxyphenyl]propoxy]-1-methylpyrazol-5-yl]propanoic acid |
| SMILES | CC(C)Oc1cc(CCCOc2cc(CCC(=O)O)n(C)n2)cc(COc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C26H30Cl2N2O5/c1-17(2)35-22-12-18(11-19(13-22)16-34-24-8-6-20(27)14-23(24)28)5-4-10-33-25-15-21(30(3)29-25)7-9-26(31)32/h6,8,11-15,17H,4-5,7,9-10,16H2,1-3H3,(H,31,32) |
| InChIKey | QXTRKKCFVBFLGV-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|