C15H13Cl2NO4 — CID 69318370
methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate (PubChem CID 69318370) has the molecular formula C15H13Cl2NO4 and a molecular weight of 342.18 g/mol. Its IUPAC name is methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate.
| Compound Name | methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 69318370 |
| Molecular Formula | C15H13Cl2NO4 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ccc(C(=O)OC)c(Oc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C15H13Cl2NO4/c1-3-21-13-7-5-10(15(19)20-2)14(18-13)22-12-6-4-9(16)8-11(12)17/h4-8H,3H2,1-2H3 |
| InChIKey | QDSBLIZMLHJFOJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |