methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate

C15H13Cl2NO4 — CID 69318370

IUPACmethyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate
SMILESCCOc1ccc(C(=O)OC)c(Oc2ccc(Cl)cc2Cl)n1
InChIInChI=1S/C15H13Cl2NO4/c1-3-21-13-7-5-10(15(19)20-2)14(18-13)22-12-6-4-9(16)8-11(12)17/h4-8H,3H2,1-2H3
InChIKeyQDSBLIZMLHJFOJ-UHFFFAOYSA-N
MW342.18 g/mol
LogP4.37
Rot. Bonds5

About methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate

methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate (PubChem CID 69318370) has the molecular formula C15H13Cl2NO4 and a molecular weight of 342.18 g/mol. Its IUPAC name is methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate.

Molecular Properties

Compound Namemethyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate
PubChem CID69318370
Molecular FormulaC15H13Cl2NO4
Molecular Weight342.18 g/mol
Exact Mass341.02
IUPAC Namemethyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate
SMILESCCOc1ccc(C(=O)OC)c(Oc2ccc(Cl)cc2Cl)n1
InChIInChI=1S/C15H13Cl2NO4/c1-3-21-13-7-5-10(15(19)20-2)14(18-13)22-12-6-4-9(16)8-11(12)17/h4-8H,3H2,1-2H3
InChIKeyQDSBLIZMLHJFOJ-UHFFFAOYSA-N
XLogP4.37
TPSA57.65 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.18
LogP ≤ 54.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate?
The IUPAC name of methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate (CID 69318370) is methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate.
What is the SMILES notation for methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate?
The canonical SMILES for methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate is CCOc1ccc(C(=O)OC)c(Oc2ccc(Cl)cc2Cl)n1.
What is the InChIKey of methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate?
The InChIKey is QDSBLIZMLHJFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13Cl2NO4/c1-3-21-13-7-5-10(15(19)20-2)14(18-13)22-12-6-4-9(16)8-11(12)17/h4-8H,3H2,1-2H3.
What are the key properties of methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate?
methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate has a molecular weight of 342.18 g/mol, XLogP of 4.37, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,4-dichlorophenoxy)-6-ethoxypyridine-3-carboxylate is sourced from PubChem (CID 69318370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).