C29H46N4O3 — CID 69319489
N-[(2S)-1-[(1-benzylpiperidin-4-yl)amino]-1,8-dioxodecan-2-yl]-1-methylpiperidine-4-carboxamide (PubChem CID 69319489) has the molecular formula C29H46N4O3 and a molecular weight of 498.71 g/mol. Its IUPAC name is N-[(2S)-1-[(1-benzylpiperidin-4-yl)amino]-1,8-dioxodecan-2-yl]-1-methylpiperidine-4-carboxamide.
| Compound Name | N-[(2S)-1-[(1-benzylpiperidin-4-yl)amino]-1,8-dioxodecan-2-yl]-1-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 69319489 |
| Molecular Formula | C29H46N4O3 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | N-[(2S)-1-[(1-benzylpiperidin-4-yl)amino]-1,8-dioxodecan-2-yl]-1-methylpiperidine-4-carboxamide |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C1CCN(C)CC1)C(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H46N4O3/c1-3-26(34)12-8-5-9-13-27(31-28(35)24-14-18-32(2)19-15-24)29(36)30-25-16-20-33(21-17-25)22-23-10-6-4-7-11-23/h4,6-7,10-11,24-25,27H,3,5,8-9,12-22H2,1-2H3,(H,30,36)(H,31,35)/t27-/m0/s1 |
| InChIKey | YXDAUOSDMGDSEH-MHZLTWQESA-N |
| XLogP | 3.52 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|