C50H28F2N8O4 — CID 69322457
2,3-bis[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]butanedinitrile (PubChem CID 69322457) has the molecular formula C50H28F2N8O4 and a molecular weight of 842.82 g/mol. Its IUPAC name is 2,3-bis[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]butanedinitrile.
| Compound Name | 2,3-bis[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]butanedinitrile |
|---|---|
| PubChem CID | 69322457 |
| Molecular Formula | C50H28F2N8O4 |
| Molecular Weight | 842.82 g/mol |
| Exact Mass | 842.22 |
| IUPAC Name | 2,3-bis[4-[8-(1,3-benzodioxol-5-yl)-7-fluoroimidazo[4,5-c]quinolin-1-yl]phenyl]butanedinitrile |
| SMILES | N#CC(c1ccc(-n2cnc3cnc4cc(F)c(-c5ccc6c(c5)OCO6)cc4c32)cc1)C(C#N)c1ccc(-n2cnc3cnc4cc(F)c(-c5ccc6c(c5)OCO6)cc4c32)cc1 |
| InChI | InChI=1S/C50H28F2N8O4/c51-39-17-41-35(15-33(39)29-5-11-45-47(13-29)63-25-61-45)49-43(21-55-41)57-23-59(49)31-7-1-27(2-8-31)37(19-53)38(20-54)28-3-9-32(10-4-28)60-24-58-44-22-56-42-18-40(52)34(16-36(42)50(44)60)30-6-12-46-48(14-30)64-26-62-46/h1-18,21-24,37-38H,25-26H2 |
| InChIKey | YFBQYCIDGUWZGS-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 145.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.82 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |