C26H25ClN2O2 — CID 69324075
(4aS)-3-[[2-(4-chlorophenyl)phenyl]methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-7-carboxylic acid (PubChem CID 69324075) has the molecular formula C26H25ClN2O2 and a molecular weight of 432.95 g/mol. Its IUPAC name is (4aS)-3-[[2-(4-chlorophenyl)phenyl]methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-7-carboxylic acid.
| Compound Name | (4aS)-3-[[2-(4-chlorophenyl)phenyl]methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 69324075 |
| Molecular Formula | C26H25ClN2O2 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (4aS)-3-[[2-(4-chlorophenyl)phenyl]methyl]-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-7-carboxylic acid |
| SMILES | O=C(O)c1cccc2c1CC[C@H]1CN(Cc3ccccc3-c3ccc(Cl)cc3)CCN21 |
| InChI | InChI=1S/C26H25ClN2O2/c27-20-10-8-18(9-11-20)22-5-2-1-4-19(22)16-28-14-15-29-21(17-28)12-13-23-24(26(30)31)6-3-7-25(23)29/h1-11,21H,12-17H2,(H,30,31)/t21-/m0/s1 |
| InChIKey | ORNVGBXAODJFPU-NRFANRHFSA-N |
| XLogP | 5.34 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |